C19H19ClN4O5S2 — CID 5153892
4-chloro-3-nitro-N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]benzamide (PubChem CID 5153892) has the molecular formula C19H19ClN4O5S2 and a molecular weight of 482.97 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-chloro-3-nitro-N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5153892 |
| Molecular Formula | C19H19ClN4O5S2 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 4-chloro-3-nitro-N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19ClN4O5S2/c20-16-9-4-13(12-17(16)24(26)27)18(25)22-19(30)21-14-5-7-15(8-6-14)31(28,29)23-10-2-1-3-11-23/h4-9,12H,1-3,10-11H2,(H2,21,22,25,30) |
| InChIKey | ULLFSTBHLDMCMS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|