C21H25N3O6S2 — CID 5175821
3,4,5-trimethoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide (PubChem CID 5175821) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5175821 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25N3O6S2/c1-28-17-12-14(13-18(29-2)19(17)30-3)20(25)23-21(31)22-15-6-8-16(9-7-15)32(26,27)24-10-4-5-11-24/h6-9,12-13H,4-5,10-11H2,1-3H3,(H2,22,23,25,31) |
| InChIKey | MTUCMYLILIMYQU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|