C24H30BrN3O4S2 — CID 4959772
3-bromo-4-hexoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide (PubChem CID 4959772) has the molecular formula C24H30BrN3O4S2 and a molecular weight of 568.56 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4959772 |
| Molecular Formula | C24H30BrN3O4S2 |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | 3-bromo-4-hexoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1Br |
| InChI | InChI=1S/C24H30BrN3O4S2/c1-2-3-4-7-16-32-22-13-8-18(17-21(22)25)23(29)27-24(33)26-19-9-11-20(12-10-19)34(30,31)28-14-5-6-15-28/h8-13,17H,2-7,14-16H2,1H3,(H2,26,27,29,33) |
| InChIKey | ORARBLURBLWLTR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|