C25H32BrN3O3S — CID 17197152
3-bromo-N-[[4-(diethylcarbamoyl)phenyl]carbamothioyl]-4-hexoxybenzamide (PubChem CID 17197152) has the molecular formula C25H32BrN3O3S and a molecular weight of 534.52 g/mol. Its IUPAC name is 3-bromo-N-[[4-(diethylcarbamoyl)phenyl]carbamothioyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[[4-(diethylcarbamoyl)phenyl]carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 17197152 |
| Molecular Formula | C25H32BrN3O3S |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 3-bromo-N-[[4-(diethylcarbamoyl)phenyl]carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(C(=O)N(CC)CC)cc2)cc1Br |
| InChI | InChI=1S/C25H32BrN3O3S/c1-4-7-8-9-16-32-22-15-12-19(17-21(22)26)23(30)28-25(33)27-20-13-10-18(11-14-20)24(31)29(5-2)6-3/h10-15,17H,4-9,16H2,1-3H3,(H2,27,28,30,33) |
| InChIKey | NJEYDVMDWUESKZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|