C26H32BrN3O3S — CID 43878252
3-bromo-4-hexoxy-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 43878252) has the molecular formula C26H32BrN3O3S and a molecular weight of 546.53 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 43878252 |
| Molecular Formula | C26H32BrN3O3S |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 3-bromo-4-hexoxy-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(C(=O)N3CCCCC3)cc2)cc1Br |
| InChI | InChI=1S/C26H32BrN3O3S/c1-2-3-4-8-17-33-23-14-11-20(18-22(23)27)24(31)29-26(34)28-21-12-9-19(10-13-21)25(32)30-15-6-5-7-16-30/h9-14,18H,2-8,15-17H2,1H3,(H2,28,29,31,34) |
| InChIKey | WBTNBQLSMZBVHP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|