C24H31BrN2O4S — CID 4959480
3-bromo-4-hexoxy-N-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 4959480) has the molecular formula C24H31BrN2O4S and a molecular weight of 523.49 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 4959480 |
| Molecular Formula | C24H31BrN2O4S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 3-bromo-4-hexoxy-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1Br |
| InChI | InChI=1S/C24H31BrN2O4S/c1-2-3-4-8-17-31-23-14-9-19(18-22(23)25)24(28)26-20-10-12-21(13-11-20)32(29,30)27-15-6-5-7-16-27/h9-14,18H,2-8,15-17H2,1H3,(H,26,28) |
| InChIKey | CFDUNCBWUDZYEY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|