C25H32BrN3O4S2 — CID 17339653
N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide (PubChem CID 17339653) has the molecular formula C25H32BrN3O4S2 and a molecular weight of 582.59 g/mol. Its IUPAC name is N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17339653 |
| Molecular Formula | C25H32BrN3O4S2 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)N3CCCCCC3)cc2)cc1Br |
| InChI | InChI=1S/C25H32BrN3O4S2/c1-18(2)13-16-33-23-12-7-19(17-22(23)26)24(30)28-25(34)27-20-8-10-21(11-9-20)35(31,32)29-14-5-3-4-6-15-29/h7-12,17-18H,3-6,13-16H2,1-2H3,(H2,27,28,30,34) |
| InChIKey | KWVUMXBWAUWULP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|