C26H28BrN3O5S2 — CID 17339575
3-bromo-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 17339575) has the molecular formula C26H28BrN3O5S2 and a molecular weight of 606.56 g/mol. Its IUPAC name is 3-bromo-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-bromo-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17339575 |
| Molecular Formula | C26H28BrN3O5S2 |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 605.07 |
| IUPAC Name | 3-bromo-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(OCCC(C)C)c(Br)c3)cc2)cc1 |
| InChI | InChI=1S/C26H28BrN3O5S2/c1-17(2)14-15-35-24-13-4-18(16-23(24)27)25(31)29-26(36)28-19-7-11-22(12-8-19)37(32,33)30-20-5-9-21(34-3)10-6-20/h4-13,16-17,30H,14-15H2,1-3H3,(H2,28,29,31,36) |
| InChIKey | PVAVPCKEXRGLHU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|