C22H20BrN3O5S2 — CID 118357440
3-bromo-N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-hydroxybenzamide (PubChem CID 118357440) has the molecular formula C22H20BrN3O5S2 and a molecular weight of 550.46 g/mol. Its IUPAC name is 3-bromo-N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-hydroxybenzamide.
| Compound Name | 3-bromo-N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 118357440 |
| Molecular Formula | C22H20BrN3O5S2 |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | 3-bromo-N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-hydroxybenzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(O)c(Br)c3)cc2)cc1 |
| InChI | InChI=1S/C22H20BrN3O5S2/c1-2-31-17-8-4-16(5-9-17)26-33(29,30)18-10-6-15(7-11-18)24-22(32)25-21(28)14-3-12-20(27)19(23)13-14/h3-13,26-27H,2H2,1H3,(H2,24,25,28,32) |
| InChIKey | ALELANAEUHJSMV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|