C28H33N3O5S2 — CID 4934033
N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-hexoxybenzamide (PubChem CID 4934033) has the molecular formula C28H33N3O5S2 and a molecular weight of 555.72 g/mol. Its IUPAC name is N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-hexoxybenzamide.
| Compound Name | N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4934033 |
| Molecular Formula | C28H33N3O5S2 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3ccc(OCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H33N3O5S2/c1-3-5-6-7-20-36-25-14-8-21(9-15-25)27(32)30-28(37)29-22-12-18-26(19-13-22)38(33,34)31-23-10-16-24(17-11-23)35-4-2/h8-19,31H,3-7,20H2,1-2H3,(H2,29,30,32,37) |
| InChIKey | HDUHYDCXGSSLIY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|