C27H30BrN3O4S2 — CID 17339587
3-bromo-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 17339587) has the molecular formula C27H30BrN3O4S2 and a molecular weight of 604.59 g/mol. Its IUPAC name is 3-bromo-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-bromo-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17339587 |
| Molecular Formula | C27H30BrN3O4S2 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | 3-bromo-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(OCCC(C)C)c(Br)c3)cc2)cc1C |
| InChI | InChI=1S/C27H30BrN3O4S2/c1-17(2)13-14-35-25-12-6-20(16-24(25)28)26(32)30-27(36)29-21-8-10-23(11-9-21)37(33,34)31-22-7-5-18(3)19(4)15-22/h5-12,15-17,31H,13-14H2,1-4H3,(H2,29,30,32,36) |
| InChIKey | FBXSIPZBRABBNH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|