C25H29N5O6S2 — CID 4949021
N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 4949021) has the molecular formula C25H29N5O6S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4949021 |
| Molecular Formula | C25H29N5O6S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(OCCC(C)C)cc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C25H29N5O6S2/c1-16(2)13-14-36-19-9-5-17(6-10-19)23(31)29-25(37)26-18-7-11-20(12-8-18)38(32,33)30-21-15-22(34-3)28-24(27-21)35-4/h5-12,15-16H,13-14H2,1-4H3,(H,27,28,30)(H2,26,29,31,37) |
| InChIKey | WUWXPNGLJLPSRT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|