C22H24N4O4S3 — CID 4949071
4-(3-methylbutoxy)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4949071) has the molecular formula C22H24N4O4S3 and a molecular weight of 504.66 g/mol. Its IUPAC name is 4-(3-methylbutoxy)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-(3-methylbutoxy)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4949071 |
| Molecular Formula | C22H24N4O4S3 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 4-(3-methylbutoxy)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O4S3/c1-15(2)11-13-30-18-7-3-16(4-8-18)20(27)25-21(31)24-17-5-9-19(10-6-17)33(28,29)26-22-23-12-14-32-22/h3-10,12,14-15H,11,13H2,1-2H3,(H,23,26)(H2,24,25,27,31) |
| InChIKey | DKRMTUNFUILSRL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|