C23H26N4O6S3 — CID 4642089
3,4,5-triethoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4642089) has the molecular formula C23H26N4O6S3 and a molecular weight of 550.68 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4642089 |
| Molecular Formula | C23H26N4O6S3 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 3,4,5-triethoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H26N4O6S3/c1-4-31-18-13-15(14-19(32-5-2)20(18)33-6-3)21(28)26-22(34)25-16-7-9-17(10-8-16)36(29,30)27-23-24-11-12-35-23/h7-14H,4-6H2,1-3H3,(H,24,27)(H2,25,26,28,34) |
| InChIKey | FGSXUTGJGLUIRJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|