C25H22N4O4S3 — CID 19628436
2-(2-phenylethoxy)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 19628436) has the molecular formula C25H22N4O4S3 and a molecular weight of 538.68 g/mol. Its IUPAC name is 2-(2-phenylethoxy)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-(2-phenylethoxy)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 19628436 |
| Molecular Formula | C25H22N4O4S3 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 2-(2-phenylethoxy)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C25H22N4O4S3/c30-23(21-8-4-5-9-22(21)33-16-14-18-6-2-1-3-7-18)28-24(34)27-19-10-12-20(13-11-19)36(31,32)29-25-26-15-17-35-25/h1-13,15,17H,14,16H2,(H,26,29)(H2,27,28,30,34) |
| InChIKey | FEDSTHXXWYGXBE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|