C19H18N4O4S3 — CID 4957664
3-ethoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4957664) has the molecular formula C19H18N4O4S3 and a molecular weight of 462.58 g/mol. Its IUPAC name is 3-ethoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-ethoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4957664 |
| Molecular Formula | C19H18N4O4S3 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 3-ethoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)c1 |
| InChI | InChI=1S/C19H18N4O4S3/c1-2-27-15-5-3-4-13(12-15)17(24)22-18(28)21-14-6-8-16(9-7-14)30(25,26)23-19-20-10-11-29-19/h3-12H,2H2,1H3,(H,20,23)(H2,21,22,24,28) |
| InChIKey | ROEQYENUMIWWDH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|