C18H18N4O3S3 — CID 25043569
1-(4-ethoxyphenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 25043569) has the molecular formula C18H18N4O3S3 and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25043569 |
| Molecular Formula | C18H18N4O3S3 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)cc1 |
| InChI | InChI=1S/C18H18N4O3S3/c1-2-25-15-7-3-13(4-8-15)20-17(26)21-14-5-9-16(10-6-14)28(23,24)22-18-19-11-12-27-18/h3-12H,2H2,1H3,(H,19,22)(H2,20,21,26) |
| InChIKey | ZTVZXXIJNFRPFM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|