C18H15N3O4S3 — CID 25048712
2-(4-methoxyphenyl)-2-sulfanylidene-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 25048712) has the molecular formula C18H15N3O4S3 and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-sulfanylidene-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-2-sulfanylidene-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 25048712 |
| Molecular Formula | C18H15N3O4S3 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-sulfanylidene-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | COc1ccc(C(=S)C(=O)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)cc1 |
| InChI | InChI=1S/C18H15N3O4S3/c1-25-14-6-2-12(3-7-14)16(26)17(22)20-13-4-8-15(9-5-13)28(23,24)21-18-19-10-11-27-18/h2-11H,1H3,(H,19,21)(H,20,22) |
| InChIKey | MEBODMGVENBWEI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|