C20H19N3O7S2 — CID 175344859
2-[(4-methoxyphenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioic acid (PubChem CID 175344859) has the molecular formula C20H19N3O7S2 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioic acid.
| Compound Name | 2-[(4-methoxyphenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioic acid |
|---|---|
| PubChem CID | 175344859 |
| Molecular Formula | C20H19N3O7S2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2-[(4-methoxyphenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioic acid |
| SMILES | COc1ccc(C(Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)C(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H19N3O7S2/c1-30-14-6-2-12(3-7-14)17(16(18(24)25)19(26)27)22-13-4-8-15(9-5-13)32(28,29)23-20-21-10-11-31-20/h2-11,16-17,22H,1H3,(H,21,23)(H,24,25)(H,26,27) |
| InChIKey | ZAYOCKASHZNOOG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|