C23H25N3O6S2 — CID 166453765
diethyl 2-[(R)-phenyl-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate (PubChem CID 166453765) has the molecular formula C23H25N3O6S2 and a molecular weight of 503.60 g/mol. Its IUPAC name is diethyl 2-[(R)-phenyl-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate.
| Compound Name | diethyl 2-[(R)-phenyl-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate |
|---|---|
| PubChem CID | 166453765 |
| Molecular Formula | C23H25N3O6S2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | diethyl 2-[(R)-phenyl-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O6S2/c1-3-31-21(27)19(22(28)32-4-2)20(16-8-6-5-7-9-16)25-17-10-12-18(13-11-17)34(29,30)26-23-24-14-15-33-23/h5-15,19-20,25H,3-4H2,1-2H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | ZFJUONTZKDJIHT-FQEVSTJZSA-N |
| XLogP | 3.84 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|