C23H24ClN3O6S2 — CID 166066769
diethyl 2-[(4-chlorophenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate (PubChem CID 166066769) has the molecular formula C23H24ClN3O6S2 and a molecular weight of 538.05 g/mol. Its IUPAC name is diethyl 2-[(4-chlorophenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate.
| Compound Name | diethyl 2-[(4-chlorophenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate |
|---|---|
| PubChem CID | 166066769 |
| Molecular Formula | C23H24ClN3O6S2 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | diethyl 2-[(4-chlorophenyl)-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClN3O6S2/c1-3-32-21(28)19(22(29)33-4-2)20(15-5-7-16(24)8-6-15)26-17-9-11-18(12-10-17)35(30,31)27-23-25-13-14-34-23/h5-14,19-20,26H,3-4H2,1-2H3,(H,25,27) |
| InChIKey | UAOJEIAGBBJUQT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|