C13H17N3O2S2 — CID 43506679
4-[1-(ethylamino)ethyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 43506679) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-[1-(ethylamino)ethyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[1-(ethylamino)ethyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43506679 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4-[1-(ethylamino)ethyl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCNC(C)c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-3-14-10(2)11-4-6-12(7-5-11)20(17,18)16-13-15-8-9-19-13/h4-10,14H,3H2,1-2H3,(H,15,16) |
| InChIKey | DVAYQGXGLGFTMZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |