C14H18N4OS — CID 61341076
1-[4-[1-(ethylamino)ethyl]phenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 61341076) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[4-[1-(ethylamino)ethyl]phenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[4-[1-(ethylamino)ethyl]phenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 61341076 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[4-[1-(ethylamino)ethyl]phenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | CCNC(C)c1ccc(NC(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-15-10(2)11-4-6-12(7-5-11)17-13(19)18-14-16-8-9-20-14/h4-10,15H,3H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | BGPPSLDCASYCMJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |