C12H14N4OS — CID 79047589
[4-[1-(1,3-thiazol-2-ylamino)ethyl]phenyl]urea (PubChem CID 79047589) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is [4-[1-(1,3-thiazol-2-ylamino)ethyl]phenyl]urea.
| Compound Name | [4-[1-(1,3-thiazol-2-ylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 79047589 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | [4-[1-(1,3-thiazol-2-ylamino)ethyl]phenyl]urea |
| SMILES | CC(Nc1nccs1)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C12H14N4OS/c1-8(15-12-14-6-7-18-12)9-2-4-10(5-3-9)16-11(13)17/h2-8H,1H3,(H,14,15)(H3,13,16,17) |
| InChIKey | IQOLOPCGIRDGEH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |