C15H20N4OS — CID 43792044
[4-[1-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]ethyl]phenyl]urea (PubChem CID 43792044) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is [4-[1-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]ethyl]phenyl]urea.
| Compound Name | [4-[1-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 43792044 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [4-[1-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]ethyl]phenyl]urea |
| SMILES | Cc1ncsc1C(C)NC(C)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C15H20N4OS/c1-9(18-11(3)14-10(2)17-8-21-14)12-4-6-13(7-5-12)19-15(16)20/h4-9,11,18H,1-3H3,(H3,16,19,20) |
| InChIKey | MTPIXTJGJZNVQN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |