C12H15N5OS — CID 107648295
[4-[1-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethyl]phenyl]urea (PubChem CID 107648295) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is [4-[1-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethyl]phenyl]urea.
| Compound Name | [4-[1-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 107648295 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [4-[1-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethyl]phenyl]urea |
| SMILES | Cc1nnc(NC(C)c2ccc(NC(N)=O)cc2)s1 |
| InChI | InChI=1S/C12H15N5OS/c1-7(14-12-17-16-8(2)19-12)9-3-5-10(6-4-9)15-11(13)18/h3-7H,1-2H3,(H,14,17)(H3,13,15,18) |
| InChIKey | DCSWGHRBOGKYRR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |