C14H19N5O — CID 104955781
[4-[1-[(1,3-dimethylpyrazol-4-yl)amino]ethyl]phenyl]urea (PubChem CID 104955781) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is [4-[1-[(1,3-dimethylpyrazol-4-yl)amino]ethyl]phenyl]urea.
| Compound Name | [4-[1-[(1,3-dimethylpyrazol-4-yl)amino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 104955781 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | [4-[1-[(1,3-dimethylpyrazol-4-yl)amino]ethyl]phenyl]urea |
| SMILES | Cc1nn(C)cc1NC(C)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C14H19N5O/c1-9(16-13-8-19(3)18-10(13)2)11-4-6-12(7-5-11)17-14(15)20/h4-9,16H,1-3H3,(H3,15,17,20) |
| InChIKey | LKPLLTZFHXLCCL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |