C14H19N5O — CID 43777234
[4-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]ethyl]phenyl]urea (PubChem CID 43777234) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is [4-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]ethyl]phenyl]urea.
| Compound Name | [4-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 43777234 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | [4-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]ethyl]phenyl]urea |
| SMILES | Cc1n[nH]c(C)c1NC(C)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C14H19N5O/c1-8(16-13-9(2)18-19-10(13)3)11-4-6-12(7-5-11)17-14(15)20/h4-8,16H,1-3H3,(H,18,19)(H3,15,17,20) |
| InChIKey | HNTUWWBXYAHULY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |