C16H20N4O — CID 43750014
[4-[1-(1-pyridin-4-ylethylamino)ethyl]phenyl]urea (PubChem CID 43750014) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is [4-[1-(1-pyridin-4-ylethylamino)ethyl]phenyl]urea.
| Compound Name | [4-[1-(1-pyridin-4-ylethylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 43750014 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [4-[1-(1-pyridin-4-ylethylamino)ethyl]phenyl]urea |
| SMILES | CC(NC(C)c1ccc(NC(N)=O)cc1)c1ccncc1 |
| InChI | InChI=1S/C16H20N4O/c1-11(19-12(2)14-7-9-18-10-8-14)13-3-5-15(6-4-13)20-16(17)21/h3-12,19H,1-2H3,(H3,17,20,21) |
| InChIKey | ZPYNDWIRJODPCG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |