C12H19N3O3 — CID 65312424
[4-[1-(1,3-dihydroxypropan-2-ylamino)ethyl]phenyl]urea (PubChem CID 65312424) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is [4-[1-(1,3-dihydroxypropan-2-ylamino)ethyl]phenyl]urea.
| Compound Name | [4-[1-(1,3-dihydroxypropan-2-ylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 65312424 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | [4-[1-(1,3-dihydroxypropan-2-ylamino)ethyl]phenyl]urea |
| SMILES | CC(NC(CO)CO)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C12H19N3O3/c1-8(14-11(6-16)7-17)9-2-4-10(5-3-9)15-12(13)18/h2-5,8,11,14,16-17H,6-7H2,1H3,(H3,13,15,18) |
| InChIKey | JECWQYNVOFDFHZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |