C15H21N5O — CID 43750027
[4-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]ethyl]phenyl]urea (PubChem CID 43750027) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is [4-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]ethyl]phenyl]urea.
| Compound Name | [4-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 43750027 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [4-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]ethyl]phenyl]urea |
| SMILES | Cc1n[nH]c(C)c1CNC(C)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C15H21N5O/c1-9(17-8-14-10(2)19-20-11(14)3)12-4-6-13(7-5-12)18-15(16)21/h4-7,9,17H,8H2,1-3H3,(H,19,20)(H3,16,18,21) |
| InChIKey | BJQVQYIRFMYXSV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |