C16H21N3OS — CID 65246401
[4-[1-[(4,5-dimethylthiophen-2-yl)methylamino]ethyl]phenyl]urea (PubChem CID 65246401) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is [4-[1-[(4,5-dimethylthiophen-2-yl)methylamino]ethyl]phenyl]urea.
| Compound Name | [4-[1-[(4,5-dimethylthiophen-2-yl)methylamino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 65246401 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | [4-[1-[(4,5-dimethylthiophen-2-yl)methylamino]ethyl]phenyl]urea |
| SMILES | Cc1cc(CNC(C)c2ccc(NC(N)=O)cc2)sc1C |
| InChI | InChI=1S/C16H21N3OS/c1-10-8-15(21-12(10)3)9-18-11(2)13-4-6-14(7-5-13)19-16(17)20/h4-8,11,18H,9H2,1-3H3,(H3,17,19,20) |
| InChIKey | FGETXVWNNFCBHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |