C11H12N2O2S — CID 107706770
5-[1-(1,3-thiazol-2-ylamino)ethyl]benzene-1,3-diol (PubChem CID 107706770) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 5-[1-(1,3-thiazol-2-ylamino)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(1,3-thiazol-2-ylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107706770 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 5-[1-(1,3-thiazol-2-ylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(Nc1nccs1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H12N2O2S/c1-7(13-11-12-2-3-16-11)8-4-9(14)6-10(15)5-8/h2-7,14-15H,1H3,(H,12,13) |
| InChIKey | OAKCJLNIEZDQOV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |