About 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol
4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol (PubChem CID 107648836) has the molecular formula C10H11N3OS
and a molecular weight of 221.29 g/mol. Its IUPAC name is 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol.
Molecular Properties
| Compound Name | 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol |
| PubChem CID | 107648836 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol |
| SMILES | CC(Nc1nncs1)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H11N3OS/c1-7(12-10-13-11-6-15-10)8-2-4-9(14)5-3-8/h2-7,14H,1H3,(H,12,13) |
| InChIKey | WMDZNWWOVQOZNO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol?
The IUPAC name of 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol (CID 107648836) is 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol.
What is the SMILES notation for 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol?
The canonical SMILES for 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol is CC(Nc1nncs1)c1ccc(O)cc1.
What is the InChIKey of 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol?
The InChIKey is WMDZNWWOVQOZNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-7(12-10-13-11-6-15-10)8-2-4-9(14)5-3-8/h2-7,14H,1H3,(H,12,13).
What are the key properties of 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol?
4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol has a molecular weight of 221.29 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(1,3,4-thiadiazol-2-ylamino)ethyl]phenol is sourced from PubChem (CID 107648836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).