C11H11N3O2S — CID 107648902
N-[1-(1,3-benzodioxol-5-yl)ethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 107648902) has the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648902 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(Nc1nncs1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H11N3O2S/c1-7(13-11-14-12-5-17-11)8-2-3-9-10(4-8)16-6-15-9/h2-5,7H,6H2,1H3,(H,13,14) |
| InChIKey | PYAISPSYAQEPDS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |