C9H10ClNO2 — CID 118697739
(1S)-1-(1,3-benzodioxol-5-yl)-N-chloroethanamine (PubChem CID 118697739) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-5-yl)-N-chloroethanamine.
| Compound Name | (1S)-1-(1,3-benzodioxol-5-yl)-N-chloroethanamine |
|---|---|
| PubChem CID | 118697739 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-5-yl)-N-chloroethanamine |
| SMILES | C[C@H](NCl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H10ClNO2/c1-6(11-10)7-2-3-8-9(4-7)13-5-12-8/h2-4,6,11H,5H2,1H3/t6-/m0/s1 |
| InChIKey | SLLJVKPJJSAJHS-LURJTMIESA-N |
| XLogP | 2.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|