C12H17NO3 — CID 43499381
1-[1-(1,3-benzodioxol-5-yl)ethylamino]propan-2-ol (PubChem CID 43499381) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)ethylamino]propan-2-ol.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 43499381 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)ethylamino]propan-2-ol |
| SMILES | CC(O)CNC(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H17NO3/c1-8(14)6-13-9(2)10-3-4-11-12(5-10)16-7-15-11/h3-5,8-9,13-14H,6-7H2,1-2H3 |
| InChIKey | GBVYTBSRLLVOTK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |