C10H13NO2 — CID 6424509
1-(1,3-benzodioxol-5-yl)-N-methylethanamine (PubChem CID 6424509) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-methylethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 6424509 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-methylethanamine |
| SMILES | CNC(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13NO2/c1-7(11-2)8-3-4-9-10(5-8)13-6-12-9/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | USAUUVXZKYYZIL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |