C11H12N4O2S — CID 61346278
1-[4-(1-hydroxyethyl)phenyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 61346278) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethyl)phenyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 61346278 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | CC(O)c1ccc(NC(=O)Nc2nncs2)cc1 |
| InChI | InChI=1S/C11H12N4O2S/c1-7(16)8-2-4-9(5-3-8)13-10(17)14-11-15-12-6-18-11/h2-7,16H,1H3,(H2,13,14,15,17) |
| InChIKey | OJMCDSPUGPBJDY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |