(2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid

C6H8N4O3S — CID 78972625

IUPAC(2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid
SMILESC[C@@H](NC(=O)Nc1nncs1)C(=O)O
InChIInChI=1S/C6H8N4O3S/c1-3(4(11)12)8-5(13)9-6-10-7-2-14-6/h2-3H,1H3,(H,11,12)(H2,8,9,10,13)/t3-/m1/s1
InChIKeyWMDBMHHHUBEMCD-GSVOUGTGSA-N
MW216.22 g/mol
LogP0.13
Rot. Bonds3

About (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid

(2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid (PubChem CID 78972625) has the molecular formula C6H8N4O3S and a molecular weight of 216.22 g/mol. Its IUPAC name is (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid.

Molecular Properties

Compound Name(2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid
PubChem CID78972625
Molecular FormulaC6H8N4O3S
Molecular Weight216.22 g/mol
Exact Mass216.03
IUPAC Name(2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid
SMILESC[C@@H](NC(=O)Nc1nncs1)C(=O)O
InChIInChI=1S/C6H8N4O3S/c1-3(4(11)12)8-5(13)9-6-10-7-2-14-6/h2-3H,1H3,(H,11,12)(H2,8,9,10,13)/t3-/m1/s1
InChIKeyWMDBMHHHUBEMCD-GSVOUGTGSA-N
XLogP0.13
TPSA104.21 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.22
LogP ≤ 50.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid?
The IUPAC name of (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid (CID 78972625) is (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid.
What is the SMILES notation for (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid?
The canonical SMILES for (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid is C[C@@H](NC(=O)Nc1nncs1)C(=O)O.
What is the InChIKey of (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid?
The InChIKey is WMDBMHHHUBEMCD-GSVOUGTGSA-N. The full InChI is InChI=1S/C6H8N4O3S/c1-3(4(11)12)8-5(13)9-6-10-7-2-14-6/h2-3H,1H3,(H,11,12)(H2,8,9,10,13)/t3-/m1/s1.
What are the key properties of (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid?
(2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid has a molecular weight of 216.22 g/mol, XLogP of 0.13, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid is sourced from PubChem (CID 78972625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).