C9H12N6OS — CID 47191680
1-(1-pyrazol-1-ylpropan-2-yl)-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 47191680) has the molecular formula C9H12N6OS and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-(1-pyrazol-1-ylpropan-2-yl)-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(1-pyrazol-1-ylpropan-2-yl)-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 47191680 |
| Molecular Formula | C9H12N6OS |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-(1-pyrazol-1-ylpropan-2-yl)-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | CC(Cn1cccn1)NC(=O)Nc1nncs1 |
| InChI | InChI=1S/C9H12N6OS/c1-7(5-15-4-2-3-11-15)12-8(16)13-9-14-10-6-17-9/h2-4,6-7H,5H2,1H3,(H2,12,13,14,16) |
| InChIKey | CIMNEIUNTWNELI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |