C14H18N4O — CID 94116600
1-(4-methylphenyl)-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea (PubChem CID 94116600) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-(4-methylphenyl)-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 94116600 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-(4-methylphenyl)-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
| SMILES | Cc1ccc(NC(=O)N[C@H](C)Cn2cccn2)cc1 |
| InChI | InChI=1S/C14H18N4O/c1-11-4-6-13(7-5-11)17-14(19)16-12(2)10-18-9-3-8-15-18/h3-9,12H,10H2,1-2H3,(H2,16,17,19)/t12-/m1/s1 |
| InChIKey | LDNXLXVGMWSLJQ-GFCCVEGCSA-N |
| XLogP | 2.40 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |