C13H15FN4O — CID 47027605
1-(2-fluorophenyl)-3-(1-pyrazol-1-ylpropan-2-yl)urea (PubChem CID 47027605) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(1-pyrazol-1-ylpropan-2-yl)urea.
| Compound Name | 1-(2-fluorophenyl)-3-(1-pyrazol-1-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 47027605 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(1-pyrazol-1-ylpropan-2-yl)urea |
| SMILES | CC(Cn1cccn1)NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C13H15FN4O/c1-10(9-18-8-4-7-15-18)16-13(19)17-12-6-3-2-5-11(12)14/h2-8,10H,9H2,1H3,(H2,16,17,19) |
| InChIKey | WEPQTWIIBJHAHT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |