C15H17F3N4O2 — CID 94028861
1-[(2R)-1-pyrazol-1-ylpropan-2-yl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 94028861) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-[(2R)-1-pyrazol-1-ylpropan-2-yl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[(2R)-1-pyrazol-1-ylpropan-2-yl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 94028861 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[(2R)-1-pyrazol-1-ylpropan-2-yl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | C[C@H](Cn1cccn1)NC(=O)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H17F3N4O2/c1-11(10-22-8-4-7-20-22)21-14(23)19-9-12-5-2-3-6-13(12)24-15(16,17)18/h2-8,11H,9-10H2,1H3,(H2,19,21,23)/t11-/m1/s1 |
| InChIKey | LKMOFMQWLRLGPP-LLVKDONJSA-N |
| XLogP | 2.67 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |