C15H15ClF3N3O2 — CID 54489471
2-chloro-N-[2-ethyl-6-(trifluoromethoxy)phenyl]-3-pyrazol-1-ylpropanamide (PubChem CID 54489471) has the molecular formula C15H15ClF3N3O2 and a molecular weight of 361.75 g/mol. Its IUPAC name is 2-chloro-N-[2-ethyl-6-(trifluoromethoxy)phenyl]-3-pyrazol-1-ylpropanamide.
| Compound Name | 2-chloro-N-[2-ethyl-6-(trifluoromethoxy)phenyl]-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 54489471 |
| Molecular Formula | C15H15ClF3N3O2 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-chloro-N-[2-ethyl-6-(trifluoromethoxy)phenyl]-3-pyrazol-1-ylpropanamide |
| SMILES | CCc1cccc(OC(F)(F)F)c1NC(=O)C(Cl)Cn1cccn1 |
| InChI | InChI=1S/C15H15ClF3N3O2/c1-2-10-5-3-6-12(24-15(17,18)19)13(10)21-14(23)11(16)9-22-8-4-7-20-22/h3-8,11H,2,9H2,1H3,(H,21,23) |
| InChIKey | XUSBALBZKNIPGD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|