C17H14F3N3O3S — CID 38944467
N-[3-(pyrazol-1-ylmethyl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 38944467) has the molecular formula C17H14F3N3O3S and a molecular weight of 397.38 g/mol. Its IUPAC name is N-[3-(pyrazol-1-ylmethyl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-(pyrazol-1-ylmethyl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 38944467 |
| Molecular Formula | C17H14F3N3O3S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[3-(pyrazol-1-ylmethyl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cn2cccn2)c1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C17H14F3N3O3S/c18-17(19,20)26-15-7-1-2-8-16(15)27(24,25)22-14-6-3-5-13(11-14)12-23-10-4-9-21-23/h1-11,22H,12H2 |
| InChIKey | WSOSNRDSRMYJTF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |