C18H19F3N2O5S2 — CID 31064984
N-(3-piperidin-1-ylsulfonylphenyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 31064984) has the molecular formula C18H19F3N2O5S2 and a molecular weight of 464.49 g/mol. Its IUPAC name is N-(3-piperidin-1-ylsulfonylphenyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-piperidin-1-ylsulfonylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 31064984 |
| Molecular Formula | C18H19F3N2O5S2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | N-(3-piperidin-1-ylsulfonylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(S(=O)(=O)N2CCCCC2)c1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O5S2/c19-18(20,21)28-16-9-2-3-10-17(16)29(24,25)22-14-7-6-8-15(13-14)30(26,27)23-11-4-1-5-12-23/h2-3,6-10,13,22H,1,4-5,11-12H2 |
| InChIKey | ZKRLJOLLXDNUMP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |