C19H24N2O4S2 — CID 71903183
3,4-dimethyl-N-(3-piperidin-1-ylsulfonylphenyl)benzenesulfonamide (PubChem CID 71903183) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 3,4-dimethyl-N-(3-piperidin-1-ylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-(3-piperidin-1-ylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71903183 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 3,4-dimethyl-N-(3-piperidin-1-ylsulfonylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)cc1C |
| InChI | InChI=1S/C19H24N2O4S2/c1-15-9-10-18(13-16(15)2)26(22,23)20-17-7-6-8-19(14-17)27(24,25)21-11-4-3-5-12-21/h6-10,13-14,20H,3-5,11-12H2,1-2H3 |
| InChIKey | LHHIQPIIKNFHHP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |