C20H26N2O2S — CID 112985765
N-[4-(azepan-1-yl)phenyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 112985765) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 112985765 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCCCCC3)cc2)cc1C |
| InChI | InChI=1S/C20H26N2O2S/c1-16-7-12-20(15-17(16)2)25(23,24)21-18-8-10-19(11-9-18)22-13-5-3-4-6-14-22/h7-12,15,21H,3-6,13-14H2,1-2H3 |
| InChIKey | PKJHHZHWUQEJRJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|