C19H24N2O3S — CID 110362056
N-(2-methoxy-5-pyrrolidin-1-ylphenyl)-3,4-dimethylbenzenesulfonamide (PubChem CID 110362056) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-(2-methoxy-5-pyrrolidin-1-ylphenyl)-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-(2-methoxy-5-pyrrolidin-1-ylphenyl)-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110362056 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-(2-methoxy-5-pyrrolidin-1-ylphenyl)-3,4-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCCC2)cc1NS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-14-6-8-17(12-15(14)2)25(22,23)20-18-13-16(7-9-19(18)24-3)21-10-4-5-11-21/h6-9,12-13,20H,4-5,10-11H2,1-3H3 |
| InChIKey | NAZPEPIFPHLHSR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|